C20H31NO2 — CID 178168043
ethane;4-ethyl-1-methylpyridin-2-one;2-methylpropoxybenzene (PubChem CID 178168043) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is ethane;4-ethyl-1-methylpyridin-2-one;2-methylpropoxybenzene.
| Compound Name | ethane;4-ethyl-1-methylpyridin-2-one;2-methylpropoxybenzene |
|---|---|
| PubChem CID | 178168043 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | ethane;4-ethyl-1-methylpyridin-2-one;2-methylpropoxybenzene |
| SMILES | CC.CC(C)COc1ccccc1.CCc1ccn(C)c(=O)c1 |
| InChI | InChI=1S/C10H14O.C8H11NO.C2H6/c1-9(2)8-11-10-6-4-3-5-7-10;1-3-7-4-5-9(2)8(10)6-7;1-2/h3-7,9H,8H2,1-2H3;4-6H,3H2,1-2H3;1-2H3 |
| InChIKey | LDRLCUULEHJTKO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |