C11H20N2 — CID 178170621
(E)-N,3-dimethyl-4-pyrrolidin-1-ylpent-3-en-2-imine (PubChem CID 178170621) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (E)-N,3-dimethyl-4-pyrrolidin-1-ylpent-3-en-2-imine.
| Compound Name | (E)-N,3-dimethyl-4-pyrrolidin-1-ylpent-3-en-2-imine |
|---|---|
| PubChem CID | 178170621 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (E)-N,3-dimethyl-4-pyrrolidin-1-ylpent-3-en-2-imine |
| SMILES | C/N=C(C)/C(C)=C(\C)N1CCCC1 |
| InChI | InChI=1S/C11H20N2/c1-9(10(2)12-4)11(3)13-7-5-6-8-13/h5-8H2,1-4H3/b11-9+,12-10+ |
| InChIKey | DDPNVWZAHQVDOM-WGDLNXRISA-N |
| XLogP | 2.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|