C32H33N2O8P — CID 178172635
[methyl(2-pyridin-2-ylethyl)carbamoyl]oxymethyl 2-[4-bis(phenylmethoxy)phosphoryloxyphenyl]acetate (PubChem CID 178172635) has the molecular formula C32H33N2O8P and a molecular weight of 604.60 g/mol. Its IUPAC name is [methyl(2-pyridin-2-ylethyl)carbamoyl]oxymethyl 2-[4-bis(phenylmethoxy)phosphoryloxyphenyl]acetate.
| Compound Name | [methyl(2-pyridin-2-ylethyl)carbamoyl]oxymethyl 2-[4-bis(phenylmethoxy)phosphoryloxyphenyl]acetate |
|---|---|
| PubChem CID | 178172635 |
| Molecular Formula | C32H33N2O8P |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | [methyl(2-pyridin-2-ylethyl)carbamoyl]oxymethyl 2-[4-bis(phenylmethoxy)phosphoryloxyphenyl]acetate |
| SMILES | CN(CCc1ccccn1)C(=O)OCOC(=O)Cc1ccc(OP(=O)(OCc2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H33N2O8P/c1-34(21-19-29-14-8-9-20-33-29)32(36)39-25-38-31(35)22-26-15-17-30(18-16-26)42-43(37,40-23-27-10-4-2-5-11-27)41-24-28-12-6-3-7-13-28/h2-18,20H,19,21-25H2,1H3 |
| InChIKey | ZXLIGNHFBCPCMV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 113.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.60 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|