C27H27NO9 — CID 178174338
[(3aR,4S,6E,9Z,11R,11aS)-6,10-dimethyl-4-[(E)-2-methylbut-2-enoyl]oxy-3-methylidene-2,8-dioxo-4,5,11,11a-tetrahydro-3aH-cyclodeca[b]furan-11-yl] 4-nitrobenzoate (PubChem CID 178174338) has the molecular formula C27H27NO9 and a molecular weight of 509.51 g/mol. Its IUPAC name is [(3aR,4S,6E,9Z,11R,11aS)-6,10-dimethyl-4-[(E)-2-methylbut-2-enoyl]oxy-3-methylidene-2,8-dioxo-4,5,11,11a-tetrahydro-3aH-cyclodeca[b]furan-11-yl] 4-nitrobenzoate.
| Compound Name | [(3aR,4S,6E,9Z,11R,11aS)-6,10-dimethyl-4-[(E)-2-methylbut-2-enoyl]oxy-3-methylidene-2,8-dioxo-4,5,11,11a-tetrahydro-3aH-cyclodeca[b]furan-11-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 178174338 |
| Molecular Formula | C27H27NO9 |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | [(3aR,4S,6E,9Z,11R,11aS)-6,10-dimethyl-4-[(E)-2-methylbut-2-enoyl]oxy-3-methylidene-2,8-dioxo-4,5,11,11a-tetrahydro-3aH-cyclodeca[b]furan-11-yl] 4-nitrobenzoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](OC(=O)/C(C)=C/C)C/C(C)=C/C(=O)/C=C(/C)[C@H]2OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H27NO9/c1-6-15(3)25(30)35-21-12-14(2)11-20(29)13-16(4)23(24-22(21)17(5)26(31)37-24)36-27(32)18-7-9-19(10-8-18)28(33)34/h6-11,13,21-24H,5,12H2,1-4H3/b14-11+,15-6+,16-13-/t21-,22+,23+,24-/m0/s1 |
| InChIKey | XNIMBZGRAVJJGS-KPZKAPFJSA-N |
| XLogP | 3.96 |
| TPSA | 139.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|