C26H33NO2 — CID 178174542
3-methyl-N-[(1R)-1-naphthalen-1-yl-4-oxopentyl]benzamide;molecular hydrogen;propane (PubChem CID 178174542) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 3-methyl-N-[(1R)-1-naphthalen-1-yl-4-oxopentyl]benzamide;molecular hydrogen;propane.
| Compound Name | 3-methyl-N-[(1R)-1-naphthalen-1-yl-4-oxopentyl]benzamide;molecular hydrogen;propane |
|---|---|
| PubChem CID | 178174542 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 3-methyl-N-[(1R)-1-naphthalen-1-yl-4-oxopentyl]benzamide;molecular hydrogen;propane |
| SMILES | CC(=O)CC[C@@H](NC(=O)c1cccc(C)c1)c1cccc2ccccc12.CCC.[H][H] |
| InChI | InChI=1S/C23H23NO2.C3H8.H2/c1-16-7-5-10-19(15-16)23(26)24-22(14-13-17(2)25)21-12-6-9-18-8-3-4-11-20(18)21;1-3-2;/h3-12,15,22H,13-14H2,1-2H3,(H,24,26);3H2,1-2H3;1H/t22-;;/m1../s1 |
| InChIKey | XICMCTHBAKRCSP-GJICFQLNSA-N |
| XLogP | 6.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |