C24H27N2O+ — CID 8701638
3-methyl-N-[(2R)-2-naphthalen-1-yl-2-pyrrolidin-1-ium-1-ylethyl]benzamide (PubChem CID 8701638) has the molecular formula C24H27N2O+ and a molecular weight of 359.49 g/mol. Its IUPAC name is 3-methyl-N-[(2R)-2-naphthalen-1-yl-2-pyrrolidin-1-ium-1-ylethyl]benzamide.
| Compound Name | 3-methyl-N-[(2R)-2-naphthalen-1-yl-2-pyrrolidin-1-ium-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 8701638 |
| Molecular Formula | C24H27N2O+ |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 3-methyl-N-[(2R)-2-naphthalen-1-yl-2-pyrrolidin-1-ium-1-ylethyl]benzamide |
| SMILES | Cc1cccc(C(=O)NC[C@@H](c2cccc3ccccc23)[NH+]2CCCC2)c1 |
| InChI | InChI=1S/C24H26N2O/c1-18-8-6-11-20(16-18)24(27)25-17-23(26-14-4-5-15-26)22-13-7-10-19-9-2-3-12-21(19)22/h2-3,6-13,16,23H,4-5,14-15,17H2,1H3,(H,25,27)/p+1/t23-/m0/s1 |
| InChIKey | LVHDIUMLQFUYBH-QHCPKHFHSA-O |
| XLogP | 3.30 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |