C25H29N2O2+ — CID 8701609
4-ethoxy-N-[(2R)-2-naphthalen-1-yl-2-pyrrolidin-1-ium-1-ylethyl]benzamide (PubChem CID 8701609) has the molecular formula C25H29N2O2+ and a molecular weight of 389.52 g/mol. Its IUPAC name is 4-ethoxy-N-[(2R)-2-naphthalen-1-yl-2-pyrrolidin-1-ium-1-ylethyl]benzamide.
| Compound Name | 4-ethoxy-N-[(2R)-2-naphthalen-1-yl-2-pyrrolidin-1-ium-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 8701609 |
| Molecular Formula | C25H29N2O2+ |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 4-ethoxy-N-[(2R)-2-naphthalen-1-yl-2-pyrrolidin-1-ium-1-ylethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC[C@@H](c2cccc3ccccc23)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C25H28N2O2/c1-2-29-21-14-12-20(13-15-21)25(28)26-18-24(27-16-5-6-17-27)23-11-7-9-19-8-3-4-10-22(19)23/h3-4,7-15,24H,2,5-6,16-18H2,1H3,(H,26,28)/p+1/t24-/m0/s1 |
| InChIKey | JLJPTJVBHGMBSI-DEOSSOPVSA-O |
| XLogP | 3.39 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |