C13H14ClNO2 — CID 178176313
1-[5-(2-chlorophenyl)-1,2-oxazol-3-yl]ethanone;ethane (PubChem CID 178176313) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 1-[5-(2-chlorophenyl)-1,2-oxazol-3-yl]ethanone;ethane.
| Compound Name | 1-[5-(2-chlorophenyl)-1,2-oxazol-3-yl]ethanone;ethane |
|---|---|
| PubChem CID | 178176313 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-[5-(2-chlorophenyl)-1,2-oxazol-3-yl]ethanone;ethane |
| SMILES | CC.CC(=O)c1cc(-c2ccccc2Cl)on1 |
| InChI | InChI=1S/C11H8ClNO2.C2H6/c1-7(14)10-6-11(15-13-10)8-4-2-3-5-9(8)12;1-2/h2-6H,1H3;1-2H3 |
| InChIKey | UZABUUOZCKLTOS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |