C9H6ClNO3 — CID 115094231
1-[5-(5-chlorofuran-2-yl)-1,2-oxazol-3-yl]ethanone (PubChem CID 115094231) has the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. Its IUPAC name is 1-[5-(5-chlorofuran-2-yl)-1,2-oxazol-3-yl]ethanone.
| Compound Name | 1-[5-(5-chlorofuran-2-yl)-1,2-oxazol-3-yl]ethanone |
|---|---|
| PubChem CID | 115094231 |
| Molecular Formula | C9H6ClNO3 |
| Molecular Weight | 211.60 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 1-[5-(5-chlorofuran-2-yl)-1,2-oxazol-3-yl]ethanone |
| SMILES | CC(=O)c1cc(-c2ccc(Cl)o2)on1 |
| InChI | InChI=1S/C9H6ClNO3/c1-5(12)6-4-8(14-11-6)7-2-3-9(10)13-7/h2-4H,1H3 |
| InChIKey | VREFJVDODNMFRL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.60 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |