C22H35NO8 — CID 178176648
1-[[10-methoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl]oxy]butane-1,1,2,2,3,3-hexol (PubChem CID 178176648) has the molecular formula C22H35NO8 and a molecular weight of 441.52 g/mol. Its IUPAC name is 1-[[10-methoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl]oxy]butane-1,1,2,2,3,3-hexol.
| Compound Name | 1-[[10-methoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl]oxy]butane-1,1,2,2,3,3-hexol |
|---|---|
| PubChem CID | 178176648 |
| Molecular Formula | C22H35NO8 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 1-[[10-methoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-9-yl]oxy]butane-1,1,2,2,3,3-hexol |
| SMILES | COc1cc2c(cc1OC(O)(O)C(O)(O)C(C)(O)O)CCN1CC(CC(C)C)CCC21 |
| InChI | InChI=1S/C22H35NO8/c1-13(2)9-14-5-6-17-16-11-18(30-4)19(10-15(16)7-8-23(17)12-14)31-22(28,29)21(26,27)20(3,24)25/h10-11,13-14,17,24-29H,5-9,12H2,1-4H3 |
| InChIKey | VXMPFWJPBGJCDR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|