C24H39NO4 — CID 142548385
(3R,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine;3-methylbutanoic acid (PubChem CID 142548385) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is (3R,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine;3-methylbutanoic acid.
| Compound Name | (3R,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine;3-methylbutanoic acid |
|---|---|
| PubChem CID | 142548385 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | (3R,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizine;3-methylbutanoic acid |
| SMILES | CC(C)CC(=O)O.COc1cc2c(cc1OC)[C@H]1CC[C@H](CC(C)C)CN1CC2 |
| InChI | InChI=1S/C19H29NO2.C5H10O2/c1-13(2)9-14-5-6-17-16-11-19(22-4)18(21-3)10-15(16)7-8-20(17)12-14;1-4(2)3-5(6)7/h10-11,13-14,17H,5-9,12H2,1-4H3;4H,3H2,1-2H3,(H,6,7)/t14-,17-;/m1./s1 |
| InChIKey | VCEVZAKZCJBAEM-SATBOSKTSA-N |
| XLogP | 5.18 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |