C24H24FN5O — CID 178177157
7-[8-amino-3-(3-methylcyclobutyl)imidazo[1,5-a]pyrazin-1-yl]-2-but-3-enyl-6-fluoroisoquinolin-1-one (PubChem CID 178177157) has the molecular formula C24H24FN5O and a molecular weight of 417.49 g/mol. Its IUPAC name is 7-[8-amino-3-(3-methylcyclobutyl)imidazo[1,5-a]pyrazin-1-yl]-2-but-3-enyl-6-fluoroisoquinolin-1-one.
| Compound Name | 7-[8-amino-3-(3-methylcyclobutyl)imidazo[1,5-a]pyrazin-1-yl]-2-but-3-enyl-6-fluoroisoquinolin-1-one |
|---|---|
| PubChem CID | 178177157 |
| Molecular Formula | C24H24FN5O |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 7-[8-amino-3-(3-methylcyclobutyl)imidazo[1,5-a]pyrazin-1-yl]-2-but-3-enyl-6-fluoroisoquinolin-1-one |
| SMILES | C=CCCn1ccc2cc(F)c(-c3nc(C4CC(C)C4)n4ccnc(N)c34)cc2c1=O |
| InChI | InChI=1S/C24H24FN5O/c1-3-4-7-29-8-5-15-12-19(25)18(13-17(15)24(29)31)20-21-22(26)27-6-9-30(21)23(28-20)16-10-14(2)11-16/h3,5-6,8-9,12-14,16H,1,4,7,10-11H2,2H3,(H2,26,27) |
| InChIKey | WCTCQCKUBQZDDH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|