C15H26OSi — CID 178178575
bis(3,3-dimethylbut-1-ynyl)-ethoxy-methylsilane (PubChem CID 178178575) has the molecular formula C15H26OSi and a molecular weight of 250.46 g/mol. Its IUPAC name is bis(3,3-dimethylbut-1-ynyl)-ethoxy-methylsilane.
| Compound Name | bis(3,3-dimethylbut-1-ynyl)-ethoxy-methylsilane |
|---|---|
| PubChem CID | 178178575 |
| Molecular Formula | C15H26OSi |
| Molecular Weight | 250.46 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | bis(3,3-dimethylbut-1-ynyl)-ethoxy-methylsilane |
| SMILES | CCO[Si](C)(C#CC(C)(C)C)C#CC(C)(C)C |
| InChI | InChI=1S/C15H26OSi/c1-9-16-17(8,12-10-14(2,3)4)13-11-15(5,6)7/h9H2,1-8H3 |
| InChIKey | NZFUIRLGUZAWEF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|