C24H25F5N6O3S — CID 178181212
N-[2-[4-[8-ethyl-2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-7-oxopyrido[2,3-d]pyrimidin-6-yl]-2,3,6-trifluorophenyl]-1-fluorocyclopropyl]methanesulfonamide (PubChem CID 178181212) has the molecular formula C24H25F5N6O3S and a molecular weight of 572.56 g/mol. Its IUPAC name is N-[2-[4-[8-ethyl-2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-7-oxopyrido[2,3-d]pyrimidin-6-yl]-2,3,6-trifluorophenyl]-1-fluorocyclopropyl]methanesulfonamide.
| Compound Name | N-[2-[4-[8-ethyl-2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-7-oxopyrido[2,3-d]pyrimidin-6-yl]-2,3,6-trifluorophenyl]-1-fluorocyclopropyl]methanesulfonamide |
|---|---|
| PubChem CID | 178181212 |
| Molecular Formula | C24H25F5N6O3S |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | N-[2-[4-[8-ethyl-2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-7-oxopyrido[2,3-d]pyrimidin-6-yl]-2,3,6-trifluorophenyl]-1-fluorocyclopropyl]methanesulfonamide |
| SMILES | CCn1c(=O)c(-c2cc(F)c(C3CC3(F)NS(C)(=O)=O)c(F)c2F)cc2cnc(N[C@@H]3CNC[C@@H](F)C3)nc21 |
| InChI | InChI=1S/C24H25F5N6O3S/c1-3-35-21-11(8-31-23(33-21)32-13-5-12(25)9-30-10-13)4-15(22(35)36)14-6-17(26)18(20(28)19(14)27)16-7-24(16,29)34-39(2,37)38/h4,6,8,12-13,16,30,34H,3,5,7,9-10H2,1-2H3,(H,31,32,33)/t12-,13-,16?,24?/m0/s1 |
| InChIKey | PKMSVWFSLYHFMU-PCQLQAPXSA-N |
| XLogP | 2.71 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|