C27H25ClF4N6O3S — CID 178181214
N-[3-chloro-2,5,6-trifluoro-4-[2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-7-oxo-8-propan-2-ylpyrido[2,3-d]pyrimidin-6-yl]phenyl]benzenesulfonamide (PubChem CID 178181214) has the molecular formula C27H25ClF4N6O3S and a molecular weight of 625.05 g/mol. Its IUPAC name is N-[3-chloro-2,5,6-trifluoro-4-[2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-7-oxo-8-propan-2-ylpyrido[2,3-d]pyrimidin-6-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-chloro-2,5,6-trifluoro-4-[2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-7-oxo-8-propan-2-ylpyrido[2,3-d]pyrimidin-6-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 178181214 |
| Molecular Formula | C27H25ClF4N6O3S |
| Molecular Weight | 625.05 g/mol |
| Exact Mass | 624.13 |
| IUPAC Name | N-[3-chloro-2,5,6-trifluoro-4-[2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-7-oxo-8-propan-2-ylpyrido[2,3-d]pyrimidin-6-yl]phenyl]benzenesulfonamide |
| SMILES | CC(C)n1c(=O)c(-c2c(F)c(F)c(NS(=O)(=O)c3ccccc3)c(F)c2Cl)cc2cnc(N[C@@H]3CNC[C@@H](F)C3)nc21 |
| InChI | InChI=1S/C27H25ClF4N6O3S/c1-13(2)38-25-14(10-34-27(36-25)35-16-9-15(29)11-33-12-16)8-18(26(38)39)19-20(28)22(31)24(23(32)21(19)30)37-42(40,41)17-6-4-3-5-7-17/h3-8,10,13,15-16,33,37H,9,11-12H2,1-2H3,(H,34,35,36)/t15-,16-/m0/s1 |
| InChIKey | CAZBJUUUIKJGQU-HOTGVXAUSA-N |
| XLogP | 5.02 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.05 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|