C26H25F4N7O3S — CID 178181205
N-[3-[4-[8-ethyl-2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-7-oxopyrido[2,3-d]pyrimidin-6-yl]-2,3,6-trifluorophenyl]-2-pyridinyl]methanesulfonamide (PubChem CID 178181205) has the molecular formula C26H25F4N7O3S and a molecular weight of 591.59 g/mol. Its IUPAC name is N-[3-[4-[8-ethyl-2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-7-oxopyrido[2,3-d]pyrimidin-6-yl]-2,3,6-trifluorophenyl]-2-pyridinyl]methanesulfonamide.
| Compound Name | N-[3-[4-[8-ethyl-2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-7-oxopyrido[2,3-d]pyrimidin-6-yl]-2,3,6-trifluorophenyl]-2-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 178181205 |
| Molecular Formula | C26H25F4N7O3S |
| Molecular Weight | 591.59 g/mol |
| Exact Mass | 591.17 |
| IUPAC Name | N-[3-[4-[8-ethyl-2-[[(3S,5S)-5-fluoropiperidin-3-yl]amino]-7-oxopyrido[2,3-d]pyrimidin-6-yl]-2,3,6-trifluorophenyl]-2-pyridinyl]methanesulfonamide |
| SMILES | CCn1c(=O)c(-c2cc(F)c(-c3cccnc3NS(C)(=O)=O)c(F)c2F)cc2cnc(N[C@@H]3CNC[C@@H](F)C3)nc21 |
| InChI | InChI=1S/C26H25F4N7O3S/c1-3-37-24-13(10-33-26(35-24)34-15-8-14(27)11-31-12-15)7-18(25(37)38)17-9-19(28)20(22(30)21(17)29)16-5-4-6-32-23(16)36-41(2,39)40/h4-7,9-10,14-15,31H,3,8,11-12H2,1-2H3,(H,32,36)(H,33,34,35)/t14-,15-/m0/s1 |
| InChIKey | KCGGLXLRNDVKSY-GJZGRUSLSA-N |
| XLogP | 3.44 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|