C20H25N3O3 — CID 178181433
benzyl 4-[3-(1-hydroxyethyl)-5-methylpyridazin-4-yl]piperidine-1-carboxylate (PubChem CID 178181433) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is benzyl 4-[3-(1-hydroxyethyl)-5-methylpyridazin-4-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[3-(1-hydroxyethyl)-5-methylpyridazin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178181433 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | benzyl 4-[3-(1-hydroxyethyl)-5-methylpyridazin-4-yl]piperidine-1-carboxylate |
| SMILES | Cc1cnnc(C(C)O)c1C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H25N3O3/c1-14-12-21-22-19(15(2)24)18(14)17-8-10-23(11-9-17)20(25)26-13-16-6-4-3-5-7-16/h3-7,12,15,17,24H,8-11,13H2,1-2H3 |
| InChIKey | WTIHVXFVFFGAQV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |