C18H26F9N4O3P — CID 178182595
bis(1-ethyl-3-methyl-2-(2,2,3,3-tetrafluoropropyl)imidazol-3-ium);fluoro-dioxido-oxo-λ5-phosphane (PubChem CID 178182595) has the molecular formula C18H26F9N4O3P and a molecular weight of 548.39 g/mol. Its IUPAC name is bis(1-ethyl-3-methyl-2-(2,2,3,3-tetrafluoropropyl)imidazol-3-ium);fluoro-dioxido-oxo-λ5-phosphane.
| Compound Name | bis(1-ethyl-3-methyl-2-(2,2,3,3-tetrafluoropropyl)imidazol-3-ium);fluoro-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 178182595 |
| Molecular Formula | C18H26F9N4O3P |
| Molecular Weight | 548.39 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | bis(1-ethyl-3-methyl-2-(2,2,3,3-tetrafluoropropyl)imidazol-3-ium);fluoro-dioxido-oxo-λ5-phosphane |
| SMILES | CCn1cc[n+](C)c1CC(F)(F)C(F)F.CCn1cc[n+](C)c1CC(F)(F)C(F)F.O=P([O-])([O-])F |
| InChI | InChI=1S/2C9H13F4N2.FH2O3P/c2*1-3-15-5-4-14(2)7(15)6-9(12,13)8(10)11;1-5(2,3)4/h2*4-5,8H,3,6H2,1-2H3;(H2,2,3,4)/q2*+1;/p-2 |
| InChIKey | PLNSQUUVWPYXHQ-UHFFFAOYSA-L |
| XLogP | 2.34 |
| TPSA | 80.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|