About fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium)
fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium) (PubChem CID 178182746) has the molecular formula C32H64FN2O3P
and a molecular weight of 574.85 g/mol. Its IUPAC name is fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium).
Molecular Properties
| Compound Name | fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium) |
| PubChem CID | 178182746 |
| Molecular Formula | C32H64FN2O3P |
| Molecular Weight | 574.85 g/mol |
| Exact Mass | 574.46 |
| IUPAC Name | fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium) |
| SMILES | C#CCC[N+](CCCC)(CCCC)CCCC.C#CCC[N+](CCCC)(CCCC)CCCC.O=P([O-])([O-])F |
| InChI | InChI=1S/2C16H32N.FH2O3P/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h2*1H,6-16H2,2-4H3;(H2,2,3,4)/q2*+1;/p-2 |
| InChIKey | IOJKCJZVPLNRLN-UHFFFAOYSA-L |
| XLogP | 7.24 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.85 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium)?
The IUPAC name of fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium) (CID 178182746) is fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium).
What is the SMILES notation for fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium)?
The canonical SMILES for fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium) is C#CCC[N+](CCCC)(CCCC)CCCC.C#CCC[N+](CCCC)(CCCC)CCCC.O=P([O-])([O-])F.
What is the InChIKey of fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium)?
The InChIKey is IOJKCJZVPLNRLN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C16H32N.FH2O3P/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h2*1H,6-16H2,2-4H3;(H2,2,3,4)/q2*+1;/p-2.
What are the key properties of fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium)?
fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium) has a molecular weight of 574.85 g/mol, XLogP of 7.24, 22 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro-dioxido-oxo-λ5-phosphane;bis(tributyl(but-3-ynyl)azanium) is sourced from PubChem (CID 178182746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).