C18H17N3O2 — CID 178186097
N-(5-imino-6,6a,12,12a-tetrahydrobenzo[a]phenoxazin-9-yl)acetamide (PubChem CID 178186097) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-(5-imino-6,6a,12,12a-tetrahydrobenzo[a]phenoxazin-9-yl)acetamide.
| Compound Name | N-(5-imino-6,6a,12,12a-tetrahydrobenzo[a]phenoxazin-9-yl)acetamide |
|---|---|
| PubChem CID | 178186097 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-(5-imino-6,6a,12,12a-tetrahydrobenzo[a]phenoxazin-9-yl)acetamide |
| SMILES | [H]/N=C1\CC2Oc3cc(NC(C)=O)ccc3NC2c2ccccc21 |
| InChI | InChI=1S/C18H17N3O2/c1-10(22)20-11-6-7-15-16(8-11)23-17-9-14(19)12-4-2-3-5-13(12)18(17)21-15/h2-8,17-19,21H,9H2,1H3,(H,20,22)/b19-14+ |
| InChIKey | BERQUKQURPORJD-XMHGGMMESA-N |
| XLogP | 3.33 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|