C19H25BrN6O3 — CID 178186789
8-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-7-hexyl-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 178186789) has the molecular formula C19H25BrN6O3 and a molecular weight of 465.35 g/mol. Its IUPAC name is 8-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-7-hexyl-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-7-hexyl-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 178186789 |
| Molecular Formula | C19H25BrN6O3 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 8-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-7-hexyl-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCCCCN1C(N/N=C/c2cc(Br)ccc2O)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C19H25BrN6O3/c1-3-4-5-6-9-26-15-16(25(2)19(29)23-17(15)28)22-18(26)24-21-11-12-10-13(20)7-8-14(12)27/h7-8,10-11,15-16,27H,3-6,9H2,1-2H3,(H,22,24)(H,23,28,29)/b21-11+ |
| InChIKey | LFWFXTXAHRLWSI-SRZZPIQSSA-N |
| XLogP | 2.21 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|