C17H21BrN6O3 — CID 156591092
8-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-propyl-4,5-dihydropurine-2,6-dione (PubChem CID 156591092) has the molecular formula C17H21BrN6O3 and a molecular weight of 437.30 g/mol. Its IUPAC name is 8-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-propyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-propyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 156591092 |
| Molecular Formula | C17H21BrN6O3 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 8-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-propyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCN1C(N/N=C/c2cc(Br)ccc2OC)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C17H21BrN6O3/c1-4-7-24-13-14(23(2)17(26)21-15(13)25)20-16(24)22-19-9-10-8-11(18)5-6-12(10)27-3/h5-6,8-9,13-14H,4,7H2,1-3H3,(H,20,22)(H,21,25,26)/b19-9+ |
| InChIKey | APTTUMCBLRZGOB-DJKKODMXSA-N |
| XLogP | 1.34 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|