C15H22N4O3 — CID 178188903
tert-butyl N-[(5E)-5-hydroxyimino-7,7-dimethyl-6,8-dihydroquinazolin-2-yl]carbamate (PubChem CID 178188903) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is tert-butyl N-[(5E)-5-hydroxyimino-7,7-dimethyl-6,8-dihydroquinazolin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(5E)-5-hydroxyimino-7,7-dimethyl-6,8-dihydroquinazolin-2-yl]carbamate |
|---|---|
| PubChem CID | 178188903 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | tert-butyl N-[(5E)-5-hydroxyimino-7,7-dimethyl-6,8-dihydroquinazolin-2-yl]carbamate |
| SMILES | CC1(C)C/C(=N\O)c2cnc(NC(=O)OC(C)(C)C)nc2C1 |
| InChI | InChI=1S/C15H22N4O3/c1-14(2,3)22-13(20)18-12-16-8-9-10(17-12)6-15(4,5)7-11(9)19-21/h8,21H,6-7H2,1-5H3,(H,16,17,18,20)/b19-11+ |
| InChIKey | NWJIRTLBNMQMDX-YBFXNURJSA-N |
| XLogP | 2.97 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|