C27H27N3O5 — CID 178191375
(E)-4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-pyrrol-2-yl)propanoyl]amino]-2-methylbut-2-enoic acid (PubChem CID 178191375) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is (E)-4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-pyrrol-2-yl)propanoyl]amino]-2-methylbut-2-enoic acid.
| Compound Name | (E)-4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-pyrrol-2-yl)propanoyl]amino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 178191375 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (E)-4-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-pyrrol-2-yl)propanoyl]amino]-2-methylbut-2-enoic acid |
| SMILES | C/C(=C\CNC(=O)C(Cc1ccc[nH]1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C27H27N3O5/c1-17(26(32)33)12-14-29-25(31)24(15-18-7-6-13-28-18)30-27(34)35-16-23-21-10-4-2-8-19(21)20-9-3-5-11-22(20)23/h2-13,23-24,28H,14-16H2,1H3,(H,29,31)(H,30,34)(H,32,33)/b17-12+ |
| InChIKey | NYKVHPIVILDCAT-SFQUDFHCSA-N |
| XLogP | 3.61 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|