C24H26N2O5 — CID 165498297
(3R)-3-[[(E)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbut-2-enoyl]amino]butanoic acid (PubChem CID 165498297) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is (3R)-3-[[(E)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbut-2-enoyl]amino]butanoic acid.
| Compound Name | (3R)-3-[[(E)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbut-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 165498297 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (3R)-3-[[(E)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbut-2-enoyl]amino]butanoic acid |
| SMILES | C/C(=C\CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@H](C)CC(=O)O |
| InChI | InChI=1S/C24H26N2O5/c1-15(23(29)26-16(2)13-22(27)28)11-12-25-24(30)31-14-21-19-9-5-3-7-17(19)18-8-4-6-10-20(18)21/h3-11,16,21H,12-14H2,1-2H3,(H,25,30)(H,26,29)(H,27,28)/b15-11+/t16-/m1/s1 |
| InChIKey | CWWNDCNMHBCZEV-RBFDBLARSA-N |
| XLogP | 3.45 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|