C28H30N2O5 — CID 178198863
(1R,5R,6S)-6-[[(E)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbut-2-enoyl]amino]bicyclo[3.2.0]heptane-3-carboxylic acid (PubChem CID 178198863) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is (1R,5R,6S)-6-[[(E)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbut-2-enoyl]amino]bicyclo[3.2.0]heptane-3-carboxylic acid.
| Compound Name | (1R,5R,6S)-6-[[(E)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbut-2-enoyl]amino]bicyclo[3.2.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 178198863 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (1R,5R,6S)-6-[[(E)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbut-2-enoyl]amino]bicyclo[3.2.0]heptane-3-carboxylic acid |
| SMILES | C/C(=C\CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@H]1C[C@H]2CC(C(=O)O)C[C@H]21 |
| InChI | InChI=1S/C28H30N2O5/c1-16(26(31)30-25-14-17-12-18(27(32)33)13-23(17)25)10-11-29-28(34)35-15-24-21-8-4-2-6-19(21)20-7-3-5-9-22(20)24/h2-10,17-18,23-25H,11-15H2,1H3,(H,29,34)(H,30,31)(H,32,33)/b16-10+/t17-,18?,23-,25+/m1/s1 |
| InChIKey | WCQKFWUMFRRFAW-AZZMVIISSA-N |
| XLogP | 4.09 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|