C28H34N2O5 — CID 178193261
(E)-4-[[(3S)-3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-5-methylhexanoyl]amino]-2-methylbut-2-enoic acid (PubChem CID 178193261) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is (E)-4-[[(3S)-3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-5-methylhexanoyl]amino]-2-methylbut-2-enoic acid.
| Compound Name | (E)-4-[[(3S)-3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-5-methylhexanoyl]amino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 178193261 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (E)-4-[[(3S)-3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-5-methylhexanoyl]amino]-2-methylbut-2-enoic acid |
| SMILES | C/C(=C\CNC(=O)C[C@@H](CNC(=O)OCC1c2ccccc2-c2ccccc21)CC(C)C)C(=O)O |
| InChI | InChI=1S/C28H34N2O5/c1-18(2)14-20(15-26(31)29-13-12-19(3)27(32)33)16-30-28(34)35-17-25-23-10-6-4-8-21(23)22-9-5-7-11-24(22)25/h4-12,18,20,25H,13-17H2,1-3H3,(H,29,31)(H,30,34)(H,32,33)/b19-12+/t20-/m0/s1 |
| InChIKey | CKWFYJMPQKMKQH-RQRMZWKBSA-N |
| XLogP | 4.72 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|