C26H26N2O5 — CID 178192807
(3R,4R)-1-[2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoyl]-4-methylpyrrolidine-3-carboxylic acid (PubChem CID 178192807) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is (3R,4R)-1-[2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoyl]-4-methylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-[2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoyl]-4-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 178192807 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (3R,4R)-1-[2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoyl]-4-methylpyrrolidine-3-carboxylic acid |
| SMILES | C#CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1C[C@H](C(=O)O)[C@@H](C)C1 |
| InChI | InChI=1S/C26H26N2O5/c1-3-8-23(24(29)28-13-16(2)21(14-28)25(30)31)27-26(32)33-15-22-19-11-6-4-9-17(19)18-10-5-7-12-20(18)22/h1,4-7,9-12,16,21-23H,8,13-15H2,2H3,(H,27,32)(H,30,31)/t16-,21-,23?/m0/s1 |
| InChIKey | IQKSJMCLNUNWSE-MDJZCCLVSA-N |
| XLogP | 3.10 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|