C28H28N2O5 — CID 178203050
(1S,6R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-4-ynoyl]-3-azabicyclo[4.1.0]heptane-7-carboxylic acid (PubChem CID 178203050) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is (1S,6R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-4-ynoyl]-3-azabicyclo[4.1.0]heptane-7-carboxylic acid.
| Compound Name | (1S,6R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-4-ynoyl]-3-azabicyclo[4.1.0]heptane-7-carboxylic acid |
|---|---|
| PubChem CID | 178203050 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | (1S,6R)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-4-ynoyl]-3-azabicyclo[4.1.0]heptane-7-carboxylic acid |
| SMILES | CC#CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1CC[C@H]2C(C(=O)O)[C@H]2C1 |
| InChI | InChI=1S/C28H28N2O5/c1-2-3-12-24(26(31)30-14-13-21-22(15-30)25(21)27(32)33)29-28(34)35-16-23-19-10-6-4-8-17(19)18-9-5-7-11-20(18)23/h4-11,21-25H,12-16H2,1H3,(H,29,34)(H,32,33)/t21-,22+,24?,25?/m1/s1 |
| InChIKey | KJWKJTLUNUOIRY-GWWFZQNBSA-N |
| XLogP | 3.49 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|