C26H28N2O6 — CID 165459919
4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-4-ynoylamino]-3-methoxybutanoic acid (PubChem CID 165459919) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-4-ynoylamino]-3-methoxybutanoic acid.
| Compound Name | 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-4-ynoylamino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 165459919 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-4-ynoylamino]-3-methoxybutanoic acid |
| SMILES | CC#CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCC(CC(=O)O)OC |
| InChI | InChI=1S/C26H28N2O6/c1-3-4-13-23(25(31)27-15-17(33-2)14-24(29)30)28-26(32)34-16-22-20-11-7-5-9-18(20)19-10-6-8-12-21(19)22/h5-12,17,22-23H,13-16H2,1-2H3,(H,27,31)(H,28,32)(H,29,30) |
| InChIKey | GYXJBRKXZNMHCP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|