C25H26N2O5 — CID 71725500
methyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoyl]amino]-2-methylpropanoate (PubChem CID 71725500) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 71725500 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | methyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoyl]amino]-2-methylpropanoate |
| SMILES | C#CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC(C)(C)C(=O)OC |
| InChI | InChI=1S/C25H26N2O5/c1-5-10-21(22(28)27-25(2,3)23(29)31-4)26-24(30)32-15-20-18-13-8-6-11-16(18)17-12-7-9-14-19(17)20/h1,6-9,11-14,20-21H,10,15H2,2-4H3,(H,26,30)(H,27,28)/t21-/m0/s1 |
| InChIKey | ZDTLVPBFEVVFCC-NRFANRHFSA-N |
| XLogP | 2.98 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|