C28H32N2O5 — CID 178193435
(1R,5S)-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoylamino]cyclohex-3-ene-1-carboxylic acid (PubChem CID 178193435) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is (1R,5S)-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoylamino]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,5S)-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoylamino]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 178193435 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (1R,5S)-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoylamino]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCC(CCC(=O)N[C@@H]1C=CC[C@@H](C(=O)O)C1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H32N2O5/c1-2-19(14-15-26(31)29-20-9-7-8-18(16-20)27(32)33)30-28(34)35-17-25-23-12-5-3-10-21(23)22-11-4-6-13-24(22)25/h3-7,9-13,18-20,25H,2,8,14-17H2,1H3,(H,29,31)(H,30,34)(H,32,33)/t18-,19?,20-/m1/s1 |
| InChIKey | LLJXHLJKOPZYQU-YSSMNDQQSA-N |
| XLogP | 4.62 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|