C27H30N2O5 — CID 178198605
(1R,5S)-5-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbutanoyl]amino]cyclohex-3-ene-1-carboxylic acid (PubChem CID 178198605) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is (1R,5S)-5-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbutanoyl]amino]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,5S)-5-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbutanoyl]amino]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 178198605 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (1R,5S)-5-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbutanoyl]amino]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCC(C)(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H]1C=CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C27H30N2O5/c1-3-27(2,25(32)28-18-10-8-9-17(15-18)24(30)31)29-26(33)34-16-23-21-13-6-4-11-19(21)20-12-5-7-14-22(20)23/h4-8,10-14,17-18,23H,3,9,15-16H2,1-2H3,(H,28,32)(H,29,33)(H,30,31)/t17-,18-,27?/m1/s1 |
| InChIKey | PPQMYDALIANZIR-BIUPWONXSA-N |
| XLogP | 4.23 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|