C28H30N2O5 — CID 178193437
(1R,5S)-5-[[(1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentanecarbonyl]amino]cyclohex-3-ene-1-carboxylic acid (PubChem CID 178193437) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is (1R,5S)-5-[[(1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentanecarbonyl]amino]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,5S)-5-[[(1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentanecarbonyl]amino]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 178193437 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (1R,5S)-5-[[(1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentanecarbonyl]amino]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(N[C@@H]1CCC[C@@H]1C(=O)N[C@@H]1C=CC[C@@H](C(=O)O)C1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H30N2O5/c31-26(29-18-8-5-7-17(15-18)27(32)33)23-13-6-14-25(23)30-28(34)35-16-24-21-11-3-1-9-19(21)20-10-2-4-12-22(20)24/h1-5,8-12,17-18,23-25H,6-7,13-16H2,(H,29,31)(H,30,34)(H,32,33)/t17-,18-,23+,25-/m1/s1 |
| InChIKey | HSANUYSURFXUGT-MGOSVXKISA-N |
| XLogP | 4.23 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|