C9H14N4O3 — CID 178194330
ethyl 1-[(3R,4S)-4-aminooxolan-3-yl]triazole-4-carboxylate (PubChem CID 178194330) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is ethyl 1-[(3R,4S)-4-aminooxolan-3-yl]triazole-4-carboxylate.
| Compound Name | ethyl 1-[(3R,4S)-4-aminooxolan-3-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 178194330 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | ethyl 1-[(3R,4S)-4-aminooxolan-3-yl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn([C@H]2COC[C@H]2N)nn1 |
| InChI | InChI=1S/C9H14N4O3/c1-2-16-9(14)7-3-13(12-11-7)8-5-15-4-6(8)10/h3,6,8H,2,4-5,10H2,1H3/t6-,8+/m1/s1 |
| InChIKey | JRLWWRZJNJJQNH-SVRRBLITSA-N |
| XLogP | -0.65 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |