C9H11NO4 — CID 146220661
ethyl 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylate (PubChem CID 146220661) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is ethyl 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 146220661 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | ethyl 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C2COC2)on1 |
| InChI | InChI=1S/C9H11NO4/c1-2-13-9(11)7-3-8(14-10-7)6-4-12-5-6/h3,6H,2,4-5H2,1H3 |
| InChIKey | UEWZXZXKWGLNRM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |