C10H14N2O3 — CID 115093875
5-(1-ethylpyrrolidin-3-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 115093875) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 5-(1-ethylpyrrolidin-3-yl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(1-ethylpyrrolidin-3-yl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 115093875 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 5-(1-ethylpyrrolidin-3-yl)-1,2-oxazole-3-carboxylic acid |
| SMILES | CCN1CCC(c2cc(C(=O)O)no2)C1 |
| InChI | InChI=1S/C10H14N2O3/c1-2-12-4-3-7(6-12)9-5-8(10(13)14)11-15-9/h5,7H,2-4,6H2,1H3,(H,13,14) |
| InChIKey | NZJQHUHXSXWTPO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |