5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid

C7H7NO4 — CID 146220605

IUPAC5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(C2COC2)on1
InChIInChI=1S/C7H7NO4/c9-7(10)5-1-6(12-8-5)4-2-11-3-4/h1,4H,2-3H2,(H,9,10)
InChIKeyUXYQUAQHIWLWQD-UHFFFAOYSA-N
MW169.14 g/mol
LogP0.49
Rot. Bonds2

About 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid

5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 146220605) has the molecular formula C7H7NO4 and a molecular weight of 169.14 g/mol. Its IUPAC name is 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid
PubChem CID146220605
Molecular FormulaC7H7NO4
Molecular Weight169.14 g/mol
Exact Mass169.04
IUPAC Name5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(C2COC2)on1
InChIInChI=1S/C7H7NO4/c9-7(10)5-1-6(12-8-5)4-2-11-3-4/h1,4H,2-3H2,(H,9,10)
InChIKeyUXYQUAQHIWLWQD-UHFFFAOYSA-N
XLogP0.49
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.14
LogP ≤ 50.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid (CID 146220605) is 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(C2COC2)on1.
What is the InChIKey of 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is UXYQUAQHIWLWQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4/c9-7(10)5-1-6(12-8-5)4-2-11-3-4/h1,4H,2-3H2,(H,9,10).
What are the key properties of 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid?
5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 169.14 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxetan-3-yl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 146220605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).