5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid

C8H9NO3S — CID 115021654

IUPAC5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(C2CCCS2)on1
InChIInChI=1S/C8H9NO3S/c10-8(11)5-4-6(12-9-5)7-2-1-3-13-7/h4,7H,1-3H2,(H,10,11)
InChIKeyRMNGKPIXZZLUQB-UHFFFAOYSA-N
MW199.23 g/mol
LogP1.94
Rot. Bonds2

About 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid

5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 115021654) has the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. Its IUPAC name is 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid
PubChem CID115021654
Molecular FormulaC8H9NO3S
Molecular Weight199.23 g/mol
Exact Mass199.03
IUPAC Name5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(C2CCCS2)on1
InChIInChI=1S/C8H9NO3S/c10-8(11)5-4-6(12-9-5)7-2-1-3-13-7/h4,7H,1-3H2,(H,10,11)
InChIKeyRMNGKPIXZZLUQB-UHFFFAOYSA-N
XLogP1.94
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.23
LogP ≤ 51.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid (CID 115021654) is 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(C2CCCS2)on1.
What is the InChIKey of 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is RMNGKPIXZZLUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3S/c10-8(11)5-4-6(12-9-5)7-2-1-3-13-7/h4,7H,1-3H2,(H,10,11).
What are the key properties of 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid?
5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 199.23 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 115021654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).