About 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid
5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 115021654) has the molecular formula C8H9NO3S
and a molecular weight of 199.23 g/mol. Its IUPAC name is 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 115021654 |
| Molecular Formula | C8H9NO3S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(C2CCCS2)on1 |
| InChI | InChI=1S/C8H9NO3S/c10-8(11)5-4-6(12-9-5)7-2-1-3-13-7/h4,7H,1-3H2,(H,10,11) |
| InChIKey | RMNGKPIXZZLUQB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid (CID 115021654) is 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(C2CCCS2)on1.
What is the InChIKey of 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is RMNGKPIXZZLUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3S/c10-8(11)5-4-6(12-9-5)7-2-1-3-13-7/h4,7H,1-3H2,(H,10,11).
What are the key properties of 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid?
5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 199.23 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(thiolan-2-yl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 115021654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).