C8H11NO2S — CID 115094035
[5-(thiolan-2-yl)-1,2-oxazol-3-yl]methanol (PubChem CID 115094035) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is [5-(thiolan-2-yl)-1,2-oxazol-3-yl]methanol.
| Compound Name | [5-(thiolan-2-yl)-1,2-oxazol-3-yl]methanol |
|---|---|
| PubChem CID | 115094035 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | [5-(thiolan-2-yl)-1,2-oxazol-3-yl]methanol |
| SMILES | OCc1cc(C2CCCS2)on1 |
| InChI | InChI=1S/C8H11NO2S/c10-5-6-4-7(11-9-6)8-2-1-3-12-8/h4,8,10H,1-3,5H2 |
| InChIKey | DOBIHOBHNWMGRQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |