C9H13NO3 — CID 115094067
[5-(oxan-2-yl)-1,2-oxazol-3-yl]methanol (PubChem CID 115094067) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is [5-(oxan-2-yl)-1,2-oxazol-3-yl]methanol.
| Compound Name | [5-(oxan-2-yl)-1,2-oxazol-3-yl]methanol |
|---|---|
| PubChem CID | 115094067 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | [5-(oxan-2-yl)-1,2-oxazol-3-yl]methanol |
| SMILES | OCc1cc(C2CCCCO2)on1 |
| InChI | InChI=1S/C9H13NO3/c11-6-7-5-9(13-10-7)8-3-1-2-4-12-8/h5,8,11H,1-4,6H2 |
| InChIKey | ASTNXZNJVUMBEP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |