C17H21NO3 — CID 69163603
cyclohexyl-[3-(hydroxymethyl)-1,2-oxazol-5-yl]-phenylmethanol (PubChem CID 69163603) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is cyclohexyl-[3-(hydroxymethyl)-1,2-oxazol-5-yl]-phenylmethanol.
| Compound Name | cyclohexyl-[3-(hydroxymethyl)-1,2-oxazol-5-yl]-phenylmethanol |
|---|---|
| PubChem CID | 69163603 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | cyclohexyl-[3-(hydroxymethyl)-1,2-oxazol-5-yl]-phenylmethanol |
| SMILES | OCc1cc(C(O)(c2ccccc2)C2CCCCC2)on1 |
| InChI | InChI=1S/C17H21NO3/c19-12-15-11-16(21-18-15)17(20,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1,3-4,7-8,11,14,19-20H,2,5-6,9-10,12H2 |
| InChIKey | AJWIGWJWZVAAMV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |