C9H13NO2S — CID 115093882
[5-(thian-4-yl)-1,2-oxazol-3-yl]methanol (PubChem CID 115093882) has the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. Its IUPAC name is [5-(thian-4-yl)-1,2-oxazol-3-yl]methanol.
| Compound Name | [5-(thian-4-yl)-1,2-oxazol-3-yl]methanol |
|---|---|
| PubChem CID | 115093882 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | [5-(thian-4-yl)-1,2-oxazol-3-yl]methanol |
| SMILES | OCc1cc(C2CCSCC2)on1 |
| InChI | InChI=1S/C9H13NO2S/c11-6-8-5-9(12-10-8)7-1-3-13-4-2-7/h5,7,11H,1-4,6H2 |
| InChIKey | ONWDKTJQSNDYFW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |