C17H26N2O3 — CID 178195072
tert-butyl N-[5-[(1S,3S)-3-(aminomethyl)-2,2-dimethylcyclopropyl]-2-hydroxyphenyl]carbamate (PubChem CID 178195072) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl N-[5-[(1S,3S)-3-(aminomethyl)-2,2-dimethylcyclopropyl]-2-hydroxyphenyl]carbamate.
| Compound Name | tert-butyl N-[5-[(1S,3S)-3-(aminomethyl)-2,2-dimethylcyclopropyl]-2-hydroxyphenyl]carbamate |
|---|---|
| PubChem CID | 178195072 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | tert-butyl N-[5-[(1S,3S)-3-(aminomethyl)-2,2-dimethylcyclopropyl]-2-hydroxyphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc([C@H]2[C@H](CN)C2(C)C)ccc1O |
| InChI | InChI=1S/C17H26N2O3/c1-16(2,3)22-15(21)19-12-8-10(6-7-13(12)20)14-11(9-18)17(14,4)5/h6-8,11,14,20H,9,18H2,1-5H3,(H,19,21)/t11-,14-/m0/s1 |
| InChIKey | HXGRMQWCEAVQCM-FZMZJTMJSA-N |
| XLogP | 3.44 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|