C10H10N2O2 — CID 178197146
5-[(E)-1-(furan-2-yl)prop-1-en-2-yl]-1,3-oxazol-2-amine (PubChem CID 178197146) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 5-[(E)-1-(furan-2-yl)prop-1-en-2-yl]-1,3-oxazol-2-amine.
| Compound Name | 5-[(E)-1-(furan-2-yl)prop-1-en-2-yl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 178197146 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 5-[(E)-1-(furan-2-yl)prop-1-en-2-yl]-1,3-oxazol-2-amine |
| SMILES | C/C(=C\c1ccco1)c1cnc(N)o1 |
| InChI | InChI=1S/C10H10N2O2/c1-7(5-8-3-2-4-13-8)9-6-12-10(11)14-9/h2-6H,1H3,(H2,11,12)/b7-5+ |
| InChIKey | YSOANIXKPNWQKZ-FNORWQNLSA-N |
| XLogP | 2.41 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |