C4H8BrN — CID 178200198
[(1R,2R)-2-bromocyclopropyl]methanamine (PubChem CID 178200198) has the molecular formula C4H8BrN and a molecular weight of 150.02 g/mol. Its IUPAC name is [(1R,2R)-2-bromocyclopropyl]methanamine.
| Compound Name | [(1R,2R)-2-bromocyclopropyl]methanamine |
|---|---|
| PubChem CID | 178200198 |
| Molecular Formula | C4H8BrN |
| Molecular Weight | 150.02 g/mol |
| Exact Mass | 148.98 |
| IUPAC Name | [(1R,2R)-2-bromocyclopropyl]methanamine |
| SMILES | NC[C@H]1C[C@H]1Br |
| InChI | InChI=1S/C4H8BrN/c5-4-1-3(4)2-6/h3-4H,1-2,6H2/t3-,4-/m1/s1 |
| InChIKey | WAARGNVEECHAMC-QWWZWVQMSA-N |
| XLogP | 0.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.02 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|