C14H13NO3 — CID 17928
spiro[2,3-dihydronaphthalene-4,3'-piperidine]-1,2',6'-trione (PubChem CID 17928) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is spiro[2,3-dihydronaphthalene-4,3'-piperidine]-1,2',6'-trione.
| Compound Name | spiro[2,3-dihydronaphthalene-4,3'-piperidine]-1,2',6'-trione |
|---|---|
| PubChem CID | 17928 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | spiro[2,3-dihydronaphthalene-4,3'-piperidine]-1,2',6'-trione |
| SMILES | O=C1CCC2(CCC(=O)c3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C14H13NO3/c16-11-5-7-14(8-6-12(17)15-13(14)18)10-4-2-1-3-9(10)11/h1-4H,5-8H2,(H,15,17,18) |
| InChIKey | WZAIVXXKOAWTGQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|