C24H31Cl2FO — CID 18004210
1,4-bis(chloromethyl)-2-[3-(3,7-dimethyloctoxy)phenyl]-5-fluorobenzene (PubChem CID 18004210) has the molecular formula C24H31Cl2FO and a molecular weight of 425.42 g/mol. Its IUPAC name is 1,4-bis(chloromethyl)-2-[3-(3,7-dimethyloctoxy)phenyl]-5-fluorobenzene.
| Compound Name | 1,4-bis(chloromethyl)-2-[3-(3,7-dimethyloctoxy)phenyl]-5-fluorobenzene |
|---|---|
| PubChem CID | 18004210 |
| Molecular Formula | C24H31Cl2FO |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1,4-bis(chloromethyl)-2-[3-(3,7-dimethyloctoxy)phenyl]-5-fluorobenzene |
| SMILES | CC(C)CCCC(C)CCOc1cccc(-c2cc(CCl)c(F)cc2CCl)c1 |
| InChI | InChI=1S/C24H31Cl2FO/c1-17(2)6-4-7-18(3)10-11-28-22-9-5-8-19(12-22)23-13-21(16-26)24(27)14-20(23)15-25/h5,8-9,12-14,17-18H,4,6-7,10-11,15-16H2,1-3H3 |
| InChIKey | GCWBEUJRKUUANF-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|