About (butan-2-ylamino) formate
(butan-2-ylamino) formate (PubChem CID 18006096) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is (butan-2-ylamino) formate.
Molecular Properties
| Compound Name | (butan-2-ylamino) formate |
| PubChem CID | 18006096 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | (butan-2-ylamino) formate |
| SMILES | CCC(C)NOC=O |
| InChI | InChI=1S/C5H11NO2/c1-3-5(2)6-8-4-7/h4-6H,3H2,1-2H3 |
| InChIKey | WWJINPAFRDVFDJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (butan-2-ylamino) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (butan-2-ylamino) formate?
The IUPAC name of (butan-2-ylamino) formate (CID 18006096) is (butan-2-ylamino) formate.
What is the SMILES notation for (butan-2-ylamino) formate?
The canonical SMILES for (butan-2-ylamino) formate is CCC(C)NOC=O.
What is the InChIKey of (butan-2-ylamino) formate?
The InChIKey is WWJINPAFRDVFDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c1-3-5(2)6-8-4-7/h4-6H,3H2,1-2H3.
What are the key properties of (butan-2-ylamino) formate?
(butan-2-ylamino) formate has a molecular weight of 117.15 g/mol, XLogP of 0.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (butan-2-ylamino) formate is sourced from PubChem (CID 18006096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).