C31H26F7N3O6 — CID 18007777
4-fluoro-3-(isoquinolin-4-ylmethoxy)-N-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)benzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 18007777) has the molecular formula C31H26F7N3O6 and a molecular weight of 669.55 g/mol. Its IUPAC name is 4-fluoro-3-(isoquinolin-4-ylmethoxy)-N-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)benzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-fluoro-3-(isoquinolin-4-ylmethoxy)-N-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)benzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 18007777 |
| Molecular Formula | C31H26F7N3O6 |
| Molecular Weight | 669.55 g/mol |
| Exact Mass | 669.17 |
| IUPAC Name | 4-fluoro-3-(isoquinolin-4-ylmethoxy)-N-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)benzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC1CCc2cc(NC(=O)c3ccc(F)c(OCc4cncc5ccccc45)c3)ccc2N1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H24FN3O2.2C2HF3O2/c1-17-6-7-18-12-22(9-11-25(18)30-17)31-27(32)19-8-10-24(28)26(13-19)33-16-21-15-29-14-20-4-2-3-5-23(20)21;2*3-2(4,5)1(6)7/h2-5,8-15,17,30H,6-7,16H2,1H3,(H,31,32);2*(H,6,7) |
| InChIKey | ONWZBCUVJDXWAF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.55 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |